C6H13N3O3 — CID 123785846
(2S)-2-amino-5-(carbamoylamino)-4,4-dideuteriopentanoic acid (PubChem CID 123785846) has the molecular formula C6H13N3O3 and a molecular weight of 177.20 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylamino)-4,4-dideuteriopentanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylamino)-4,4-dideuteriopentanoic acid |
|---|---|
| PubChem CID | 123785846 |
| Molecular Formula | C6H13N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)-4,4-dideuteriopentanoic acid |
| SMILES | [2H]C([2H])(CNC(N)=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1/i1D2 |
| InChIKey | RHGKLRLOHDJJDR-XAPGESQUSA-N |
| XLogP | -1.15 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |