C6H13N3O4 — CID 121421901
(2S)-2-amino-3-[2-(carbamoylamino)ethoxy]propanoic acid (PubChem CID 121421901) has the molecular formula C6H13N3O4 and a molecular weight of 191.19 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(carbamoylamino)ethoxy]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(carbamoylamino)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 121421901 |
| Molecular Formula | C6H13N3O4 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | (2S)-2-amino-3-[2-(carbamoylamino)ethoxy]propanoic acid |
| SMILES | NC(=O)NCCOC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13N3O4/c7-4(5(10)11)3-13-2-1-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1 |
| InChIKey | DDPYQHZVLYCNID-BYPYZUCNSA-N |
| XLogP | -1.92 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|