C6H12N2O5 — CID 118658592
(2S)-2-amino-3-[(2R)-2-amino-2-carboxyethoxy]propanoic acid (PubChem CID 118658592) has the molecular formula C6H12N2O5 and a molecular weight of 192.17 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2R)-2-amino-2-carboxyethoxy]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(2R)-2-amino-2-carboxyethoxy]propanoic acid |
|---|---|
| PubChem CID | 118658592 |
| Molecular Formula | C6H12N2O5 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | (2S)-2-amino-3-[(2R)-2-amino-2-carboxyethoxy]propanoic acid |
| SMILES | N[C@H](COC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H12N2O5/c7-3(5(9)10)1-13-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4+ |
| InChIKey | KHWNEMYTFXMKRC-ZXZARUISSA-N |
| XLogP | -2.17 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |