About sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride
sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride (PubChem CID 174769406) has the molecular formula C5H15N2NaO3S
and a molecular weight of 206.24 g/mol. Its IUPAC name is sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride.
Molecular Properties
| Compound Name | sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride |
| PubChem CID | 174769406 |
| Molecular Formula | C5H15N2NaO3S |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride |
| SMILES | CC(CCN)C(N)S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C5H14N2O3S.Na.H/c1-4(2-3-6)5(7)11(8,9)10;;/h4-5H,2-3,6-7H2,1H3,(H,8,9,10);;/q;+1;-1 |
| InChIKey | DOJGZXVRRRWTEN-UHFFFAOYSA-N |
| XLogP | -3.74 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride?
The IUPAC name of sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride (CID 174769406) is sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride.
What is the SMILES notation for sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride?
The canonical SMILES for sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride is CC(CCN)C(N)S(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride?
The InChIKey is DOJGZXVRRRWTEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O3S.Na.H/c1-4(2-3-6)5(7)11(8,9)10;;/h4-5H,2-3,6-7H2,1H3,(H,8,9,10);;/q;+1;-1.
What are the key properties of sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride?
sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride has a molecular weight of 206.24 g/mol, XLogP of -3.74, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1,4-diamino-2-methylbutane-1-sulfonic acid;hydride is sourced from PubChem (CID 174769406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).