About (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol
(Z)-4,7-diamino-5-methylhept-2-ene-3-thiol (PubChem CID 89154085) has the molecular formula C8H18N2S
and a molecular weight of 174.31 g/mol. Its IUPAC name is (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol.
Molecular Properties
| Compound Name | (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol |
| PubChem CID | 89154085 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol |
| SMILES | C/C=C(\S)C(N)C(C)CCN |
| InChI | InChI=1S/C8H18N2S/c1-3-7(11)8(10)6(2)4-5-9/h3,6,8,11H,4-5,9-10H2,1-2H3/b7-3- |
| InChIKey | KRTXZUGLIZGGHT-CLTKARDFSA-N |
| XLogP | 1.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol?
The IUPAC name of (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol (CID 89154085) is (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol.
What is the SMILES notation for (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol?
The canonical SMILES for (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol is C/C=C(\S)C(N)C(C)CCN.
What is the InChIKey of (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol?
The InChIKey is KRTXZUGLIZGGHT-CLTKARDFSA-N. The full InChI is InChI=1S/C8H18N2S/c1-3-7(11)8(10)6(2)4-5-9/h3,6,8,11H,4-5,9-10H2,1-2H3/b7-3-.
What are the key properties of (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol?
(Z)-4,7-diamino-5-methylhept-2-ene-3-thiol has a molecular weight of 174.31 g/mol, XLogP of 1.13, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol is sourced from PubChem (CID 89154085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).