C8H18N2S — CID 89154085
(Z)-4,7-diamino-5-methylhept-2-ene-3-thiol (PubChem CID 89154085) has the molecular formula C8H18N2S and a molecular weight of 174.31 g/mol. Its IUPAC name is (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol.
| Compound Name | (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol |
|---|---|
| PubChem CID | 89154085 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (Z)-4,7-diamino-5-methylhept-2-ene-3-thiol |
| SMILES | C/C=C(\S)C(N)C(C)CCN |
| InChI | InChI=1S/C8H18N2S/c1-3-7(11)8(10)6(2)4-5-9/h3,6,8,11H,4-5,9-10H2,1-2H3/b7-3- |
| InChIKey | KRTXZUGLIZGGHT-CLTKARDFSA-N |
| XLogP | 1.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|