C4H11BrN2 — CID 12531074
4-bromobutane-1,3-diamine (PubChem CID 12531074) has the molecular formula C4H11BrN2 and a molecular weight of 167.05 g/mol. Its IUPAC name is 4-bromobutane-1,3-diamine.
| Compound Name | 4-bromobutane-1,3-diamine |
|---|---|
| PubChem CID | 12531074 |
| Molecular Formula | C4H11BrN2 |
| Molecular Weight | 167.05 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 4-bromobutane-1,3-diamine |
| SMILES | NCCC(N)CBr |
| InChI | InChI=1S/C4H11BrN2/c5-3-4(7)1-2-6/h4H,1-3,6-7H2 |
| InChIKey | GXPBHLANDLOOHV-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.05 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|