C10H28N6 — CID 153410752
1-N-(2-aminoethyl)-1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine (PubChem CID 153410752) has the molecular formula C10H28N6 and a molecular weight of 232.38 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)-1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine.
| Compound Name | 1-N-(2-aminoethyl)-1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine |
|---|---|
| PubChem CID | 153410752 |
| Molecular Formula | C10H28N6 |
| Molecular Weight | 232.38 g/mol |
| Exact Mass | 232.24 |
| IUPAC Name | 1-N-(2-aminoethyl)-1-N-[2-(2-aminoethylamino)ethyl]butane-1,2,4-triamine |
| SMILES | NCCNCCN(CCN)CC(N)CCN |
| InChI | InChI=1S/C10H28N6/c11-2-1-10(14)9-16(7-4-13)8-6-15-5-3-12/h10,15H,1-9,11-14H2 |
| InChIKey | RYGVDQIAKDPVCN-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 119.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.38 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|