C9H24N4 — CID 129302821
(2S)-1-N,1-N-bis(2-aminoethyl)pentane-1,2-diamine (PubChem CID 129302821) has the molecular formula C9H24N4 and a molecular weight of 188.32 g/mol. Its IUPAC name is (2S)-1-N,1-N-bis(2-aminoethyl)pentane-1,2-diamine.
| Compound Name | (2S)-1-N,1-N-bis(2-aminoethyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 129302821 |
| Molecular Formula | C9H24N4 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.20 |
| IUPAC Name | (2S)-1-N,1-N-bis(2-aminoethyl)pentane-1,2-diamine |
| SMILES | CCC[C@H](N)CN(CCN)CCN |
| InChI | InChI=1S/C9H24N4/c1-2-3-9(12)8-13(6-4-10)7-5-11/h9H,2-8,10-12H2,1H3/t9-/m0/s1 |
| InChIKey | BACCVFLINAOEPF-VIFPVBQESA-N |
| XLogP | -0.67 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |