C8H22N2OSi — CID 150032402
5-[ethoxy(methyl)silyl]pentane-1,3-diamine (PubChem CID 150032402) has the molecular formula C8H22N2OSi and a molecular weight of 190.36 g/mol. Its IUPAC name is 5-[ethoxy(methyl)silyl]pentane-1,3-diamine.
| Compound Name | 5-[ethoxy(methyl)silyl]pentane-1,3-diamine |
|---|---|
| PubChem CID | 150032402 |
| Molecular Formula | C8H22N2OSi |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-[ethoxy(methyl)silyl]pentane-1,3-diamine |
| SMILES | CCO[SiH](C)CCC(N)CCN |
| InChI | InChI=1S/C8H22N2OSi/c1-3-11-12(2)7-5-8(10)4-6-9/h8,12H,3-7,9-10H2,1-2H3 |
| InChIKey | DHNTULVMEJFNCS-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|