C5H15N2O3S- — CID 174426349
hydrogen sulfite;pentane-1,3-diamine (PubChem CID 174426349) has the molecular formula C5H15N2O3S- and a molecular weight of 183.25 g/mol. Its IUPAC name is hydrogen sulfite;pentane-1,3-diamine.
| Compound Name | hydrogen sulfite;pentane-1,3-diamine |
|---|---|
| PubChem CID | 174426349 |
| Molecular Formula | C5H15N2O3S- |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | hydrogen sulfite;pentane-1,3-diamine |
| SMILES | CCC(N)CCN.O=S([O-])O |
| InChI | InChI=1S/C5H14N2.H2O3S/c1-2-5(7)3-4-6;1-4(2)3/h5H,2-4,6-7H2,1H3;(H2,1,2,3)/p-1 |
| InChIKey | HJICTRDQNRPFRN-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|