About hydrogen sulfite;3-methyldecane;yttrium
hydrogen sulfite;3-methyldecane;yttrium (PubChem CID 59289682) has the molecular formula C11H24O3SY-2
and a molecular weight of 325.28 g/mol. Its IUPAC name is hydrogen sulfite;3-methyldecane;yttrium.
Molecular Properties
| Compound Name | hydrogen sulfite;3-methyldecane;yttrium |
| PubChem CID | 59289682 |
| Molecular Formula | C11H24O3SY-2 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | hydrogen sulfite;3-methyldecane;yttrium |
| SMILES | CCCC[CH-]CCC(C)CC.O=S([O-])O.[Y] |
| InChI | InChI=1S/C11H23.H2O3S.Y/c1-4-6-7-8-9-10-11(3)5-2;1-4(2)3;/h8,11H,4-7,9-10H2,1-3H3;(H2,1,2,3);/q-1;;/p-1 |
| InChIKey | MVHFULBUUYJSRL-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;3-methyldecane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;3-methyldecane;yttrium?
The IUPAC name of hydrogen sulfite;3-methyldecane;yttrium (CID 59289682) is hydrogen sulfite;3-methyldecane;yttrium.
What is the SMILES notation for hydrogen sulfite;3-methyldecane;yttrium?
The canonical SMILES for hydrogen sulfite;3-methyldecane;yttrium is CCCC[CH-]CCC(C)CC.O=S([O-])O.[Y].
What is the InChIKey of hydrogen sulfite;3-methyldecane;yttrium?
The InChIKey is MVHFULBUUYJSRL-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H23.H2O3S.Y/c1-4-6-7-8-9-10-11(3)5-2;1-4(2)3;/h8,11H,4-7,9-10H2,1-3H3;(H2,1,2,3);/q-1;;/p-1.
What are the key properties of hydrogen sulfite;3-methyldecane;yttrium?
hydrogen sulfite;3-methyldecane;yttrium has a molecular weight of 325.28 g/mol, XLogP of 3.54, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;3-methyldecane;yttrium is sourced from PubChem (CID 59289682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).