About pentan-3-amine;yttrium(3+)
pentan-3-amine;yttrium(3+) (PubChem CID 23541288) has the molecular formula C5H12NY+2
and a molecular weight of 175.06 g/mol. Its IUPAC name is pentan-3-amine;yttrium(3+).
Molecular Properties
| Compound Name | pentan-3-amine;yttrium(3+) |
| PubChem CID | 23541288 |
| Molecular Formula | C5H12NY+2 |
| Molecular Weight | 175.06 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | pentan-3-amine;yttrium(3+) |
| SMILES | [CH2-]CC(N)CC.[Y+3] |
| InChI | InChI=1S/C5H12N.Y/c1-3-5(6)4-2;/h5H,1,3-4,6H2,2H3;/q-1;+3 |
| InChIKey | CKMIJGCTBKQBLU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.06 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze pentan-3-amine;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-amine;yttrium(3+)?
The IUPAC name of pentan-3-amine;yttrium(3+) (CID 23541288) is pentan-3-amine;yttrium(3+).
What is the SMILES notation for pentan-3-amine;yttrium(3+)?
The canonical SMILES for pentan-3-amine;yttrium(3+) is [CH2-]CC(N)CC.[Y+3].
What is the InChIKey of pentan-3-amine;yttrium(3+)?
The InChIKey is CKMIJGCTBKQBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N.Y/c1-3-5(6)4-2;/h5H,1,3-4,6H2,2H3;/q-1;+3.
What are the key properties of pentan-3-amine;yttrium(3+)?
pentan-3-amine;yttrium(3+) has a molecular weight of 175.06 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-amine;yttrium(3+) is sourced from PubChem (CID 23541288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).