C10H22O8 — CID 89098556
(3S)-2-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethoxy]pentane-1,3,4-triol (PubChem CID 89098556) has the molecular formula C10H22O8 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3S)-2-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethoxy]pentane-1,3,4-triol.
| Compound Name | (3S)-2-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethoxy]pentane-1,3,4-triol |
|---|---|
| PubChem CID | 89098556 |
| Molecular Formula | C10H22O8 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (3S)-2-[(1R)-1-(1,3-dihydroxypropan-2-yloxy)-2-hydroxyethoxy]pentane-1,3,4-triol |
| SMILES | CC(O)[C@H](O)C(CO)O[C@H](CO)OC(CO)CO |
| InChI | InChI=1S/C10H22O8/c1-6(15)10(16)8(4-13)18-9(5-14)17-7(2-11)3-12/h6-16H,2-5H2,1H3/t6?,8?,9-,10+/m1/s1 |
| InChIKey | HJZSIMQSHSJKPT-HEVNLOSJSA-N |
| XLogP | -3.21 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|