C12H32N2O — CID 142843711
4,5-diamino-2-methylpentan-1-ol;ethane;2-methylpropane (PubChem CID 142843711) has the molecular formula C12H32N2O and a molecular weight of 220.40 g/mol. Its IUPAC name is 4,5-diamino-2-methylpentan-1-ol;ethane;2-methylpropane.
| Compound Name | 4,5-diamino-2-methylpentan-1-ol;ethane;2-methylpropane |
|---|---|
| PubChem CID | 142843711 |
| Molecular Formula | C12H32N2O |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.25 |
| IUPAC Name | 4,5-diamino-2-methylpentan-1-ol;ethane;2-methylpropane |
| SMILES | CC.CC(C)C.CC(CO)CC(N)CN |
| InChI | InChI=1S/C6H16N2O.C4H10.C2H6/c1-5(4-9)2-6(8)3-7;1-4(2)3;1-2/h5-6,9H,2-4,7-8H2,1H3;4H,1-3H3;1-2H3 |
| InChIKey | AGOGBPPGCJHBPG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |