C10H22O2 — CID 10329806
(2R,4S,5S)-2,4,6-trimethylheptane-1,5-diol (PubChem CID 10329806) has the molecular formula C10H22O2 and a molecular weight of 174.28 g/mol. Its IUPAC name is (2R,4S,5S)-2,4,6-trimethylheptane-1,5-diol.
| Compound Name | (2R,4S,5S)-2,4,6-trimethylheptane-1,5-diol |
|---|---|
| PubChem CID | 10329806 |
| Molecular Formula | C10H22O2 |
| Molecular Weight | 174.28 g/mol |
| Exact Mass | 174.16 |
| IUPAC Name | (2R,4S,5S)-2,4,6-trimethylheptane-1,5-diol |
| SMILES | CC(C)[C@H](O)[C@@H](C)C[C@@H](C)CO |
| InChI | InChI=1S/C10H22O2/c1-7(2)10(12)9(4)5-8(3)6-11/h7-12H,5-6H2,1-4H3/t8-,9+,10+/m1/s1 |
| InChIKey | POSMSTCLBZDLEH-UTLUCORTSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |