C12H22OW — CID 59856239
(3S,4R)-2,4,6-trimethylnon-7-yn-3-ol;tungsten (PubChem CID 59856239) has the molecular formula C12H22OW and a molecular weight of 366.15 g/mol. Its IUPAC name is (3S,4R)-2,4,6-trimethylnon-7-yn-3-ol;tungsten.
| Compound Name | (3S,4R)-2,4,6-trimethylnon-7-yn-3-ol;tungsten |
|---|---|
| PubChem CID | 59856239 |
| Molecular Formula | C12H22OW |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (3S,4R)-2,4,6-trimethylnon-7-yn-3-ol;tungsten |
| SMILES | CC#CC(C)C[C@@H](C)[C@@H](O)C(C)C.[W] |
| InChI | InChI=1S/C12H22O.W/c1-6-7-10(4)8-11(5)12(13)9(2)3;/h9-13H,8H2,1-5H3;/t10?,11-,12+;/m1./s1 |
| InChIKey | PNNMPOPQOPJMEN-TZUZVIBKSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|