C10H24INO2 — CID 87971936
acetic acid;N,N-diethylbutan-2-amine;hydroiodide (PubChem CID 87971936) has the molecular formula C10H24INO2 and a molecular weight of 317.21 g/mol. Its IUPAC name is acetic acid;N,N-diethylbutan-2-amine;hydroiodide.
| Compound Name | acetic acid;N,N-diethylbutan-2-amine;hydroiodide |
|---|---|
| PubChem CID | 87971936 |
| Molecular Formula | C10H24INO2 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | acetic acid;N,N-diethylbutan-2-amine;hydroiodide |
| SMILES | CC(=O)O.CCC(C)N(CC)CC.I |
| InChI | InChI=1S/C8H19N.C2H4O2.HI/c1-5-8(4)9(6-2)7-3;1-2(3)4;/h8H,5-7H2,1-4H3;1H3,(H,3,4);1H |
| InChIKey | DHNHXJOTJSMPGZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|