C13H27NO2 — CID 161380270
N,N-diethylpentan-2-amine;2-methylprop-2-enoic acid (PubChem CID 161380270) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N,N-diethylpentan-2-amine;2-methylprop-2-enoic acid.
| Compound Name | N,N-diethylpentan-2-amine;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 161380270 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N,N-diethylpentan-2-amine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCCC(C)N(CC)CC |
| InChI | InChI=1S/C9H21N.C4H6O2/c1-5-8-9(4)10(6-2)7-3;1-3(2)4(5)6/h9H,5-8H2,1-4H3;1H2,2H3,(H,5,6) |
| InChIKey | VRPYKAFJAZSFTB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|