C15H27NO4 — CID 141011598
methyl 3-(diethylamino)-2-methylidenepentanoate;2-methylprop-2-enoic acid (PubChem CID 141011598) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is methyl 3-(diethylamino)-2-methylidenepentanoate;2-methylprop-2-enoic acid.
| Compound Name | methyl 3-(diethylamino)-2-methylidenepentanoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 141011598 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | methyl 3-(diethylamino)-2-methylidenepentanoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C(=O)OC)C(CC)N(CC)CC.C=C(C)C(=O)O |
| InChI | InChI=1S/C11H21NO2.C4H6O2/c1-6-10(12(7-2)8-3)9(4)11(13)14-5;1-3(2)4(5)6/h10H,4,6-8H2,1-3,5H3;1H2,2H3,(H,5,6) |
| InChIKey | NEXXPEIGYMJKMB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|