C18H38O4 — CID 87737483
9-(2-hydroxyethyl)hexadecane-1,1,16-triol (PubChem CID 87737483) has the molecular formula C18H38O4 and a molecular weight of 318.50 g/mol. Its IUPAC name is 9-(2-hydroxyethyl)hexadecane-1,1,16-triol.
| Compound Name | 9-(2-hydroxyethyl)hexadecane-1,1,16-triol |
|---|---|
| PubChem CID | 87737483 |
| Molecular Formula | C18H38O4 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.28 |
| IUPAC Name | 9-(2-hydroxyethyl)hexadecane-1,1,16-triol |
| SMILES | OCCCCCCCC(CCO)CCCCCCCC(O)O |
| InChI | InChI=1S/C18H38O4/c19-15-10-6-2-4-8-12-17(14-16-20)11-7-3-1-5-9-13-18(21)22/h17-22H,1-16H2 |
| InChIKey | MMQZDMPUCKTBTE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|