C11H12O2 — CID 54350652
1-phenylpent-4-yne-2,3-diol (PubChem CID 54350652) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-phenylpent-4-yne-2,3-diol.
| Compound Name | 1-phenylpent-4-yne-2,3-diol |
|---|---|
| PubChem CID | 54350652 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-phenylpent-4-yne-2,3-diol |
| SMILES | C#CC(O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-2-10(12)11(13)8-9-6-4-3-5-7-9/h1,3-7,10-13H,8H2 |
| InChIKey | JTDUVZFQYDSCSR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|