C17H12F5NO — CID 101254025
(3R,4R)-4-(2,3,4,5,6-pentafluoroanilino)-5-phenylpent-1-yn-3-ol (PubChem CID 101254025) has the molecular formula C17H12F5NO and a molecular weight of 341.28 g/mol. Its IUPAC name is (3R,4R)-4-(2,3,4,5,6-pentafluoroanilino)-5-phenylpent-1-yn-3-ol.
| Compound Name | (3R,4R)-4-(2,3,4,5,6-pentafluoroanilino)-5-phenylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 101254025 |
| Molecular Formula | C17H12F5NO |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (3R,4R)-4-(2,3,4,5,6-pentafluoroanilino)-5-phenylpent-1-yn-3-ol |
| SMILES | C#C[C@@H](O)[C@@H](Cc1ccccc1)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H12F5NO/c1-2-11(24)10(8-9-6-4-3-5-7-9)23-17-15(21)13(19)12(18)14(20)16(17)22/h1,3-7,10-11,23-24H,8H2/t10-,11-/m1/s1 |
| InChIKey | SCOPVIWORYVAMQ-GHMZBOCLSA-N |
| XLogP | 3.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|