C4H7NO3 — CID 130677506
(2R,3R)-2,3,4-trihydroxybutanenitrile (PubChem CID 130677506) has the molecular formula C4H7NO3 and a molecular weight of 117.10 g/mol. Its IUPAC name is (2R,3R)-2,3,4-trihydroxybutanenitrile.
| Compound Name | (2R,3R)-2,3,4-trihydroxybutanenitrile |
|---|---|
| PubChem CID | 130677506 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | (2R,3R)-2,3,4-trihydroxybutanenitrile |
| SMILES | N#C[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C4H7NO3/c5-1-3(7)4(8)2-6/h3-4,6-8H,2H2/t3-,4-/m1/s1 |
| InChIKey | YDXGXFDEPLKGAQ-QWWZWVQMSA-N |
| XLogP | -1.78 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|