C4H4N2O2 — CID 102473790
(2S,3S)-2,3-dihydroxybutanedinitrile (PubChem CID 102473790) has the molecular formula C4H4N2O2 and a molecular weight of 112.09 g/mol. Its IUPAC name is (2S,3S)-2,3-dihydroxybutanedinitrile.
| Compound Name | (2S,3S)-2,3-dihydroxybutanedinitrile |
|---|---|
| PubChem CID | 102473790 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | (2S,3S)-2,3-dihydroxybutanedinitrile |
| SMILES | N#C[C@H](O)[C@@H](O)C#N |
| InChI | InChI=1S/C4H4N2O2/c5-1-3(7)4(8)2-6/h3-4,7-8H/t3-,4-/m0/s1 |
| InChIKey | RNYXHSLVKXGAFG-IMJSIDKUSA-N |
| XLogP | -1.24 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|