C9H8FNO — CID 23234191
(2S,3R)-3-fluoro-2-hydroxy-3-phenylpropanenitrile (PubChem CID 23234191) has the molecular formula C9H8FNO and a molecular weight of 165.17 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-2-hydroxy-3-phenylpropanenitrile.
| Compound Name | (2S,3R)-3-fluoro-2-hydroxy-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 23234191 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | (2S,3R)-3-fluoro-2-hydroxy-3-phenylpropanenitrile |
| SMILES | N#C[C@H](O)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C9H8FNO/c10-9(8(12)6-11)7-4-2-1-3-5-7/h1-5,8-9,12H/t8-,9+/m0/s1 |
| InChIKey | CRXNDXHWTAEEOF-DTWKUNHWSA-N |
| XLogP | 1.58 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|