C7H13NO6 — CID 88610400
(2R,3S,4R,5R)-2,3,4,5,6,7-hexahydroxyheptanenitrile (PubChem CID 88610400) has the molecular formula C7H13NO6 and a molecular weight of 207.18 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6,7-hexahydroxyheptanenitrile.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6,7-hexahydroxyheptanenitrile |
|---|---|
| PubChem CID | 88610400 |
| Molecular Formula | C7H13NO6 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6,7-hexahydroxyheptanenitrile |
| SMILES | N#C[C@@H](O)[C@H](O)[C@@H](O)[C@H](O)C(O)CO |
| InChI | InChI=1S/C7H13NO6/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3-7,9-14H,2H2/t3-,4?,5+,6-,7-/m1/s1 |
| InChIKey | PBGHYNHJTYOYAD-SYFPXZNOSA-N |
| XLogP | -3.69 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|