C6H12N2O4 — CID 11593529
(2R,3R,4S,5R)-2-(15N)azanyl-3,4,5,6-tetrahydroxy(113C)hexanenitrile (PubChem CID 11593529) has the molecular formula C6H12N2O4 and a molecular weight of 178.16 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(15N)azanyl-3,4,5,6-tetrahydroxy(113C)hexanenitrile.
| Compound Name | (2R,3R,4S,5R)-2-(15N)azanyl-3,4,5,6-tetrahydroxy(113C)hexanenitrile |
|---|---|
| PubChem CID | 11593529 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2R,3R,4S,5R)-2-(15N)azanyl-3,4,5,6-tetrahydroxy(113C)hexanenitrile |
| SMILES | N#[13C][C@@H]([15NH2])[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12N2O4/c7-1-3(8)5(11)6(12)4(10)2-9/h3-6,9-12H,2,8H2/t3-,4-,5-,6-/m1/s1/i1+1,8+1 |
| InChIKey | KPYSOEIBJBHDPC-QPLZHHGZSA-N |
| XLogP | -3.09 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |