C10H22O5 — CID 91301231
5-(3-hydroxypropyl)heptane-1,1,6,7-tetrol (PubChem CID 91301231) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is 5-(3-hydroxypropyl)heptane-1,1,6,7-tetrol.
| Compound Name | 5-(3-hydroxypropyl)heptane-1,1,6,7-tetrol |
|---|---|
| PubChem CID | 91301231 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 5-(3-hydroxypropyl)heptane-1,1,6,7-tetrol |
| SMILES | OCCCC(CCCC(O)O)C(O)CO |
| InChI | InChI=1S/C10H22O5/c11-6-2-4-8(9(13)7-12)3-1-5-10(14)15/h8-15H,1-7H2 |
| InChIKey | GCTNRGTYKGYFAW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|