C12H26O2 — CID 132503720
(2S,3R)-3-propylnonane-1,2-diol (PubChem CID 132503720) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is (2S,3R)-3-propylnonane-1,2-diol.
| Compound Name | (2S,3R)-3-propylnonane-1,2-diol |
|---|---|
| PubChem CID | 132503720 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | (2S,3R)-3-propylnonane-1,2-diol |
| SMILES | CCCCCC[C@@H](CCC)[C@H](O)CO |
| InChI | InChI=1S/C12H26O2/c1-3-5-6-7-9-11(8-4-2)12(14)10-13/h11-14H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | UQHOSISPAXWLMZ-VXGBXAGGSA-N |
| XLogP | 2.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|