About 3-ethylnon-8-yne-4,5-diol
3-ethylnon-8-yne-4,5-diol (PubChem CID 103459637) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 3-ethylnon-8-yne-4,5-diol.
Molecular Properties
| Compound Name | 3-ethylnon-8-yne-4,5-diol |
| PubChem CID | 103459637 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 3-ethylnon-8-yne-4,5-diol |
| SMILES | C#CCCC(O)C(O)C(CC)CC |
| InChI | InChI=1S/C11H20O2/c1-4-7-8-10(12)11(13)9(5-2)6-3/h1,9-13H,5-8H2,2-3H3 |
| InChIKey | CGKFTQHPVMUPIY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylnon-8-yne-4,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylnon-8-yne-4,5-diol?
The IUPAC name of 3-ethylnon-8-yne-4,5-diol (CID 103459637) is 3-ethylnon-8-yne-4,5-diol.
What is the SMILES notation for 3-ethylnon-8-yne-4,5-diol?
The canonical SMILES for 3-ethylnon-8-yne-4,5-diol is C#CCCC(O)C(O)C(CC)CC.
What is the InChIKey of 3-ethylnon-8-yne-4,5-diol?
The InChIKey is CGKFTQHPVMUPIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-7-8-10(12)11(13)9(5-2)6-3/h1,9-13H,5-8H2,2-3H3.
What are the key properties of 3-ethylnon-8-yne-4,5-diol?
3-ethylnon-8-yne-4,5-diol has a molecular weight of 184.28 g/mol, XLogP of 1.56, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylnon-8-yne-4,5-diol is sourced from PubChem (CID 103459637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).