C23H34O3 — CID 54539932
7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol (PubChem CID 54539932) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol |
|---|---|
| PubChem CID | 54539932 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylbutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol |
| SMILES | OCC=CCCCC[C@@H]1[C@H](CCC(O)Cc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H34O3/c24-16-8-3-1-2-7-11-20-21(23-15-14-22(20)26-23)13-12-19(25)17-18-9-5-4-6-10-18/h3-6,8-10,19-25H,1-2,7,11-17H2/t19?,20-,21+,22-,23+/m1/s1 |
| InChIKey | ZCKYTQSOKJBMFI-NQNKTMCVSA-N |
| XLogP | 4.27 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|