C22H38O3 — CID 57018049
7-[3-(3-cyclopentyl-3-hydroxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol (PubChem CID 57018049) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is 7-[3-(3-cyclopentyl-3-hydroxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol.
| Compound Name | 7-[3-(3-cyclopentyl-3-hydroxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol |
|---|---|
| PubChem CID | 57018049 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | 7-[3-(3-cyclopentyl-3-hydroxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-2-en-1-ol |
| SMILES | CC(O)(CCC1C2CCC(O2)C1CCCCC=CCO)C1CCCC1 |
| InChI | InChI=1S/C22H38O3/c1-22(24,17-9-6-7-10-17)15-14-19-18(20-12-13-21(19)25-20)11-5-3-2-4-8-16-23/h4,8,17-21,23-24H,2-3,5-7,9-16H2,1H3 |
| InChIKey | TYPGCZBGFFSDOB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|