C12H20O3 — CID 54240888
[3-(4-methoxybut-3-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol (PubChem CID 54240888) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is [3-(4-methoxybut-3-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol.
| Compound Name | [3-(4-methoxybut-3-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol |
|---|---|
| PubChem CID | 54240888 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | [3-(4-methoxybut-3-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol |
| SMILES | COC=CCCC1C2CCC(O2)C1CO |
| InChI | InChI=1S/C12H20O3/c1-14-7-3-2-4-9-10(8-13)12-6-5-11(9)15-12/h3,7,9-13H,2,4-6,8H2,1H3 |
| InChIKey | QPXOMLMCNDGAHB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|