About 2-cyclohexyl-6,6,6-trifluorohexan-2-ol
2-cyclohexyl-6,6,6-trifluorohexan-2-ol (PubChem CID 116535957) has the molecular formula C12H21F3O
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-cyclohexyl-6,6,6-trifluorohexan-2-ol.
Molecular Properties
| Compound Name | 2-cyclohexyl-6,6,6-trifluorohexan-2-ol |
| PubChem CID | 116535957 |
| Molecular Formula | C12H21F3O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-cyclohexyl-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H21F3O/c1-11(16,8-5-9-12(13,14)15)10-6-3-2-4-7-10/h10,16H,2-9H2,1H3 |
| InChIKey | KHHOOXZYSZFDJV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-6,6,6-trifluorohexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-6,6,6-trifluorohexan-2-ol?
The IUPAC name of 2-cyclohexyl-6,6,6-trifluorohexan-2-ol (CID 116535957) is 2-cyclohexyl-6,6,6-trifluorohexan-2-ol.
What is the SMILES notation for 2-cyclohexyl-6,6,6-trifluorohexan-2-ol?
The canonical SMILES for 2-cyclohexyl-6,6,6-trifluorohexan-2-ol is CC(O)(CCCC(F)(F)F)C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-6,6,6-trifluorohexan-2-ol?
The InChIKey is KHHOOXZYSZFDJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3O/c1-11(16,8-5-9-12(13,14)15)10-6-3-2-4-7-10/h10,16H,2-9H2,1H3.
What are the key properties of 2-cyclohexyl-6,6,6-trifluorohexan-2-ol?
2-cyclohexyl-6,6,6-trifluorohexan-2-ol has a molecular weight of 238.29 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-6,6,6-trifluorohexan-2-ol is sourced from PubChem (CID 116535957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).