C12H21F3O — CID 116535957
2-cyclohexyl-6,6,6-trifluorohexan-2-ol (PubChem CID 116535957) has the molecular formula C12H21F3O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-cyclohexyl-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-cyclohexyl-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 116535957 |
| Molecular Formula | C12H21F3O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 2-cyclohexyl-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H21F3O/c1-11(16,8-5-9-12(13,14)15)10-6-3-2-4-7-10/h10,16H,2-9H2,1H3 |
| InChIKey | KHHOOXZYSZFDJV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |