C13H23F3O3S — CID 116535923
6,6,6-trifluoro-2-(3-methylsulfonylcyclohexyl)hexan-2-ol (PubChem CID 116535923) has the molecular formula C13H23F3O3S and a molecular weight of 316.39 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-(3-methylsulfonylcyclohexyl)hexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-(3-methylsulfonylcyclohexyl)hexan-2-ol |
|---|---|
| PubChem CID | 116535923 |
| Molecular Formula | C13H23F3O3S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 6,6,6-trifluoro-2-(3-methylsulfonylcyclohexyl)hexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H23F3O3S/c1-12(17,7-4-8-13(14,15)16)10-5-3-6-11(9-10)20(2,18)19/h10-11,17H,3-9H2,1-2H3 |
| InChIKey | WHSMFHFVYNDVMU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |