C16H23FO3S — CID 114832922
1-(2-fluorophenyl)-2-(3-methylsulfonylcyclohexyl)propan-2-ol (PubChem CID 114832922) has the molecular formula C16H23FO3S and a molecular weight of 314.42 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(3-methylsulfonylcyclohexyl)propan-2-ol.
| Compound Name | 1-(2-fluorophenyl)-2-(3-methylsulfonylcyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 114832922 |
| Molecular Formula | C16H23FO3S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(3-methylsulfonylcyclohexyl)propan-2-ol |
| SMILES | CC(O)(Cc1ccccc1F)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C16H23FO3S/c1-16(18,11-12-6-3-4-9-15(12)17)13-7-5-8-14(10-13)21(2,19)20/h3-4,6,9,13-14,18H,5,7-8,10-11H2,1-2H3 |
| InChIKey | KNTNOZZZOZCRFJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |