C13H20O4S — CID 113315410
1-(furan-3-yl)-1-(3-methylsulfonylcyclohexyl)ethanol (PubChem CID 113315410) has the molecular formula C13H20O4S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(furan-3-yl)-1-(3-methylsulfonylcyclohexyl)ethanol.
| Compound Name | 1-(furan-3-yl)-1-(3-methylsulfonylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 113315410 |
| Molecular Formula | C13H20O4S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-(furan-3-yl)-1-(3-methylsulfonylcyclohexyl)ethanol |
| SMILES | CC(O)(c1ccoc1)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H20O4S/c1-13(14,11-6-7-17-9-11)10-4-3-5-12(8-10)18(2,15)16/h6-7,9-10,12,14H,3-5,8H2,1-2H3 |
| InChIKey | LKCFOJBMQGEGEA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |