C13H18O4S — CID 104799669
(3-methylfuran-2-yl)-(3-methylsulfonylcyclohexyl)methanone (PubChem CID 104799669) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (3-methylfuran-2-yl)-(3-methylsulfonylcyclohexyl)methanone.
| Compound Name | (3-methylfuran-2-yl)-(3-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 104799669 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3-methylfuran-2-yl)-(3-methylsulfonylcyclohexyl)methanone |
| SMILES | Cc1ccoc1C(=O)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H18O4S/c1-9-6-7-17-13(9)12(14)10-4-3-5-11(8-10)18(2,15)16/h6-7,10-11H,3-5,8H2,1-2H3 |
| InChIKey | MRMLQNGMBCGHSE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |