C16H18O3S2 — CID 115786097
1-benzothiophen-2-yl-(3-methylsulfonylcyclohexyl)methanone (PubChem CID 115786097) has the molecular formula C16H18O3S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-(3-methylsulfonylcyclohexyl)methanone.
| Compound Name | 1-benzothiophen-2-yl-(3-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 115786097 |
| Molecular Formula | C16H18O3S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-benzothiophen-2-yl-(3-methylsulfonylcyclohexyl)methanone |
| SMILES | CS(=O)(=O)C1CCCC(C(=O)c2cc3ccccc3s2)C1 |
| InChI | InChI=1S/C16H18O3S2/c1-21(18,19)13-7-4-6-12(9-13)16(17)15-10-11-5-2-3-8-14(11)20-15/h2-3,5,8,10,12-13H,4,6-7,9H2,1H3 |
| InChIKey | BMPHPVWKDNLOKY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |