C14H15BrF2O3S — CID 115785925
(4-bromo-2,6-difluorophenyl)-(3-methylsulfonylcyclohexyl)methanone (PubChem CID 115785925) has the molecular formula C14H15BrF2O3S and a molecular weight of 381.24 g/mol. Its IUPAC name is (4-bromo-2,6-difluorophenyl)-(3-methylsulfonylcyclohexyl)methanone.
| Compound Name | (4-bromo-2,6-difluorophenyl)-(3-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 115785925 |
| Molecular Formula | C14H15BrF2O3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | (4-bromo-2,6-difluorophenyl)-(3-methylsulfonylcyclohexyl)methanone |
| SMILES | CS(=O)(=O)C1CCCC(C(=O)c2c(F)cc(Br)cc2F)C1 |
| InChI | InChI=1S/C14H15BrF2O3S/c1-21(19,20)10-4-2-3-8(5-10)14(18)13-11(16)6-9(15)7-12(13)17/h6-8,10H,2-5H2,1H3 |
| InChIKey | QSJZHMAIRTWKHR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |