C15H20O2 — CID 162415284
(E)-6-[(2R,3R)-3-benzyloxiran-2-yl]hex-2-en-1-ol (PubChem CID 162415284) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (E)-6-[(2R,3R)-3-benzyloxiran-2-yl]hex-2-en-1-ol.
| Compound Name | (E)-6-[(2R,3R)-3-benzyloxiran-2-yl]hex-2-en-1-ol |
|---|---|
| PubChem CID | 162415284 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (E)-6-[(2R,3R)-3-benzyloxiran-2-yl]hex-2-en-1-ol |
| SMILES | OC/C=C/CCC[C@H]1O[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C15H20O2/c16-11-7-2-1-6-10-14-15(17-14)12-13-8-4-3-5-9-13/h2-5,7-9,14-16H,1,6,10-12H2/b7-2+/t14-,15-/m1/s1 |
| InChIKey | XKKMMELSKRUAPQ-FNKCSIJBSA-N |
| XLogP | 2.72 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|