About (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol
(E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol (PubChem CID 162415511) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol |
| PubChem CID | 162415511 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol |
| SMILES | CC(O)/C=C/CCC[C@H]1O[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H22O2/c1-13(17)8-4-2-7-11-15-16(18-15)12-14-9-5-3-6-10-14/h3-6,8-10,13,15-17H,2,7,11-12H2,1H3/b8-4+/t13?,15-,16-/m1/s1 |
| InChIKey | REQMYESJHACJPE-AINSHPHKSA-N |
| XLogP | 3.10 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol?
The IUPAC name of (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol (CID 162415511) is (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol.
What is the SMILES notation for (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol?
The canonical SMILES for (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol is CC(O)/C=C/CCC[C@H]1O[C@@H]1Cc1ccccc1.
What is the InChIKey of (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol?
The InChIKey is REQMYESJHACJPE-AINSHPHKSA-N. The full InChI is InChI=1S/C16H22O2/c1-13(17)8-4-2-7-11-15-16(18-15)12-14-9-5-3-6-10-14/h3-6,8-10,13,15-17H,2,7,11-12H2,1H3/b8-4+/t13?,15-,16-/m1/s1.
What are the key properties of (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol?
(E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol has a molecular weight of 246.35 g/mol, XLogP of 3.10, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-7-[(2R,3R)-3-benzyloxiran-2-yl]hept-3-en-2-ol is sourced from PubChem (CID 162415511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).