C30H49NO4 — CID 163085604
2-[2-(2-aminoethyl)-6-benzyl-3-(6-hydroxyundec-4-enyl)cyclohexyl]-3-hydroxybutanoic acid (PubChem CID 163085604) has the molecular formula C30H49NO4 and a molecular weight of 487.73 g/mol. Its IUPAC name is 2-[2-(2-aminoethyl)-6-benzyl-3-(6-hydroxyundec-4-enyl)cyclohexyl]-3-hydroxybutanoic acid.
| Compound Name | 2-[2-(2-aminoethyl)-6-benzyl-3-(6-hydroxyundec-4-enyl)cyclohexyl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 163085604 |
| Molecular Formula | C30H49NO4 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 487.37 |
| IUPAC Name | 2-[2-(2-aminoethyl)-6-benzyl-3-(6-hydroxyundec-4-enyl)cyclohexyl]-3-hydroxybutanoic acid |
| SMILES | CCCCCC(O)C=CCCCC1CCC(Cc2ccccc2)C(C(C(=O)O)C(C)O)C1CCN |
| InChI | InChI=1S/C30H49NO4/c1-3-4-7-15-26(33)16-11-6-10-14-24-17-18-25(21-23-12-8-5-9-13-23)29(27(24)19-20-31)28(22(2)32)30(34)35/h5,8-9,11-13,16,22,24-29,32-33H,3-4,6-7,10,14-15,17-21,31H2,1-2H3,(H,34,35) |
| InChIKey | MQYCSIAKLWQYQP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|