C45H65NO3 — CID 162805502
(2R,3S)-2-[(1R,5R,6R)-6-(2-aminoethyl)-5-[(2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]-2-(1-phenylcyclohexyl)cyclohex-3-en-1-yl]-3-hydroxybutanoic acid (PubChem CID 162805502) has the molecular formula C45H65NO3 and a molecular weight of 668.02 g/mol. Its IUPAC name is (2R,3S)-2-[(1R,5R,6R)-6-(2-aminoethyl)-5-[(2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]-2-(1-phenylcyclohexyl)cyclohex-3-en-1-yl]-3-hydroxybutanoic acid.
| Compound Name | (2R,3S)-2-[(1R,5R,6R)-6-(2-aminoethyl)-5-[(2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]-2-(1-phenylcyclohexyl)cyclohex-3-en-1-yl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 162805502 |
| Molecular Formula | C45H65NO3 |
| Molecular Weight | 668.02 g/mol |
| Exact Mass | 667.50 |
| IUPAC Name | (2R,3S)-2-[(1R,5R,6R)-6-(2-aminoethyl)-5-[(2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]-2-(1-phenylcyclohexyl)cyclohex-3-en-1-yl]-3-hydroxybutanoic acid |
| SMILES | C[C@H](O)[C@H](C(=O)O)[C@H]1C(C2(c3ccccc3)CCCCC2)C=C[C@@H](C[C@@H](CC=CCCC2CCCCC2)CCc2ccccc2)[C@H]1CCN |
| InChI | InChI=1S/C45H65NO3/c1-34(47)42(44(48)49)43-40(29-32-46)38(27-28-41(43)45(30-15-6-16-31-45)39-23-13-5-14-24-39)33-37(26-25-36-20-10-3-11-21-36)22-12-4-9-19-35-17-7-2-8-18-35/h3-5,10-14,20-21,23-24,27-28,34-35,37-38,40-43,47H,2,6-9,15-19,22,25-26,29-33,46H2,1H3,(H,48,49)/t34-,37-,38-,40+,41?,42-,43+/m0/s1 |
| InChIKey | NHGUGBMFPOALTR-YXWOTDPTSA-N |
| XLogP | 10.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.02 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|