C33H53NO2 — CID 162811390
4-(2-aminoethyl)-12-cyclohexyl-3-[(1-phenylcyclohexyl)methyl]dodec-9-enoic acid (PubChem CID 162811390) has the molecular formula C33H53NO2 and a molecular weight of 495.79 g/mol. Its IUPAC name is 4-(2-aminoethyl)-12-cyclohexyl-3-[(1-phenylcyclohexyl)methyl]dodec-9-enoic acid.
| Compound Name | 4-(2-aminoethyl)-12-cyclohexyl-3-[(1-phenylcyclohexyl)methyl]dodec-9-enoic acid |
|---|---|
| PubChem CID | 162811390 |
| Molecular Formula | C33H53NO2 |
| Molecular Weight | 495.79 g/mol |
| Exact Mass | 495.41 |
| IUPAC Name | 4-(2-aminoethyl)-12-cyclohexyl-3-[(1-phenylcyclohexyl)methyl]dodec-9-enoic acid |
| SMILES | NCCC(CCCCC=CCCC1CCCCC1)C(CC(=O)O)CC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C33H53NO2/c34-25-22-29(19-11-4-2-1-3-8-16-28-17-9-5-10-18-28)30(26-32(35)36)27-33(23-14-7-15-24-33)31-20-12-6-13-21-31/h1,3,6,12-13,20-21,28-30H,2,4-5,7-11,14-19,22-27,34H2,(H,35,36) |
| InChIKey | HCLUWEYDXBJZAQ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.79 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|