C28H44O2 — CID 163094085
(Z,3S)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid (PubChem CID 163094085) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is (Z,3S)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid.
| Compound Name | (Z,3S)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
|---|---|
| PubChem CID | 163094085 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | (Z,3S)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
| SMILES | CCCCCC/C=C\CCCCC[C@H](CC(=O)O)CC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C28H44O2/c1-2-3-4-5-6-7-8-9-10-11-13-18-25(23-27(29)30)24-28(21-16-17-22-28)26-19-14-12-15-20-26/h7-8,12,14-15,19-20,25H,2-6,9-11,13,16-18,21-24H2,1H3,(H,29,30)/b8-7-/t25-/m1/s1 |
| InChIKey | OTBMLOFKTFBJOH-CNXHMKESSA-N |
| XLogP | 8.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|