C31H50O3 — CID 163103153
(Z,2S,3R)-2-[(1S)-1-hydroxyethyl]-3-[(1-phenylcyclohexyl)methyl]hexadec-9-enoic acid (PubChem CID 163103153) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is (Z,2S,3R)-2-[(1S)-1-hydroxyethyl]-3-[(1-phenylcyclohexyl)methyl]hexadec-9-enoic acid.
| Compound Name | (Z,2S,3R)-2-[(1S)-1-hydroxyethyl]-3-[(1-phenylcyclohexyl)methyl]hexadec-9-enoic acid |
|---|---|
| PubChem CID | 163103153 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | (Z,2S,3R)-2-[(1S)-1-hydroxyethyl]-3-[(1-phenylcyclohexyl)methyl]hexadec-9-enoic acid |
| SMILES | CCCCCC/C=C\CCCCC[C@H](CC1(c2ccccc2)CCCCC1)[C@H](C(=O)O)[C@H](C)O |
| InChI | InChI=1S/C31H50O3/c1-3-4-5-6-7-8-9-10-11-12-15-20-27(29(26(2)32)30(33)34)25-31(23-18-14-19-24-31)28-21-16-13-17-22-28/h8-9,13,16-17,21-22,26-27,29,32H,3-7,10-12,14-15,18-20,23-25H2,1-2H3,(H,33,34)/b9-8-/t26-,27+,29+/m0/s1 |
| InChIKey | BWVOVISWNFSMBG-SPEVCABTSA-N |
| XLogP | 8.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|