C28H44O3 — CID 162824506
(3S,11R)-11-hydroxy-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid (PubChem CID 162824506) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is (3S,11R)-11-hydroxy-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid.
| Compound Name | (3S,11R)-11-hydroxy-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
|---|---|
| PubChem CID | 162824506 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | (3S,11R)-11-hydroxy-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
| SMILES | CCCCC[C@@H](O)C=CCCCCC[C@H](CC(=O)O)CC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C28H44O3/c1-2-3-8-18-26(29)19-12-6-4-5-9-15-24(22-27(30)31)23-28(20-13-14-21-28)25-16-10-7-11-17-25/h7,10-12,16-17,19,24,26,29H,2-6,8-9,13-15,18,20-23H2,1H3,(H,30,31)/t24-,26-/m1/s1 |
| InChIKey | OAOCEVAYSWPAAE-AOYPEHQESA-N |
| XLogP | 7.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|