C32H53NO3 — CID 162865010
4-(2-aminoethyl)-2-(1-hydroxyethyl)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid (PubChem CID 162865010) has the molecular formula C32H53NO3 and a molecular weight of 499.78 g/mol. Its IUPAC name is 4-(2-aminoethyl)-2-(1-hydroxyethyl)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid.
| Compound Name | 4-(2-aminoethyl)-2-(1-hydroxyethyl)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
|---|---|
| PubChem CID | 162865010 |
| Molecular Formula | C32H53NO3 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 499.40 |
| IUPAC Name | 4-(2-aminoethyl)-2-(1-hydroxyethyl)-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
| SMILES | CCCCCCC=CCCCCC(CCN)C(CC1(c2ccccc2)CCCC1)C(C(=O)O)C(C)O |
| InChI | InChI=1S/C32H53NO3/c1-3-4-5-6-7-8-9-10-11-13-18-27(21-24-33)29(30(26(2)34)31(35)36)25-32(22-16-17-23-32)28-19-14-12-15-20-28/h8-9,12,14-15,19-20,26-27,29-30,34H,3-7,10-11,13,16-18,21-25,33H2,1-2H3,(H,35,36) |
| InChIKey | DBVWVYJTXUHIGU-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|