C30H51NO3 — CID 162804495
(2S,3S,4R,7R)-4-(2-aminoethyl)-7-ethyl-2-[(1S)-1-hydroxyethyl]-3-(2-phenylethyl)hexadec-9-enoic acid (PubChem CID 162804495) has the molecular formula C30H51NO3 and a molecular weight of 473.74 g/mol. Its IUPAC name is (2S,3S,4R,7R)-4-(2-aminoethyl)-7-ethyl-2-[(1S)-1-hydroxyethyl]-3-(2-phenylethyl)hexadec-9-enoic acid.
| Compound Name | (2S,3S,4R,7R)-4-(2-aminoethyl)-7-ethyl-2-[(1S)-1-hydroxyethyl]-3-(2-phenylethyl)hexadec-9-enoic acid |
|---|---|
| PubChem CID | 162804495 |
| Molecular Formula | C30H51NO3 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.39 |
| IUPAC Name | (2S,3S,4R,7R)-4-(2-aminoethyl)-7-ethyl-2-[(1S)-1-hydroxyethyl]-3-(2-phenylethyl)hexadec-9-enoic acid |
| SMILES | CCCCCCC=CC[C@H](CC)CC[C@H](CCN)[C@H](CCc1ccccc1)[C@H](C(=O)O)[C@H](C)O |
| InChI | InChI=1S/C30H51NO3/c1-4-6-7-8-9-10-12-15-25(5-2)18-20-27(22-23-31)28(29(24(3)32)30(33)34)21-19-26-16-13-11-14-17-26/h10-14,16-17,24-25,27-29,32H,4-9,15,18-23,31H2,1-3H3,(H,33,34)/t24-,25-,27+,28-,29+/m0/s1 |
| InChIKey | IMDWSLVMYBVGNG-DCJUPOQYSA-N |
| XLogP | 7.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|